3-Hydroxy Desloratadine D4 Hydrobromide
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02970 |
| Alternative Name(s) | 8chloro-6,11-dihydro-11-(4-piperidinylidene)-5H-benzo[5 3-Hydroxydesloratadine-d4; ch 45581-d4; |
| Research Area | An active labelled metabolite of Loratadine.;Labeled Desloratadine, intended for use as an internal standard for the quantification of Desloratadine by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H15DClN2OBr |
| CAS# | 119410-08-1 (Unlabeled)(Freebase) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=CC=C2C(CCC3=CC(O)=CN=C3/C2=C4C([2H])C([2H])NC([2H])C4[2H])=C1.Br |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02970.html |
| Additional Information | NULL |