Rocuronium bromide 50mg
Rocuronium bromide is an aminosteroid non-depolarizing neuromuscular blocker and also is used as a muscle relaxant used in modern anesthesia to facilitate endotracheal intubation.
| Trivial name | Rocuronium bromide 50mg |
| Catalog Number | A10803-50 |
| Alternative Name(s) | 1-((2S,3S,5S,8R,9S,10S,13S,14S,16S,17R)-17-acetoxy-3-hydroxy-10,13-dimethyl-2-morpholinohexadecahydro-1H-cyclopenta[a]phenanthren-16-yl)-1-allylpyrrolidinium bromide |
| Molecular Formula | C32H53BrN2O4 |
| CAS# | 119302-91-9 |
| SMILES | CC(=O)O[C@H]1[C@H](C[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@@H]4[C@@]3(C[C@@H]([C@H](C4)O)N5CCOCC5)C)C)[N+]6(CCCC6)CC=C.[Br-] |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/rocuronium-bromide.html |
