Rocuronium Bromide EP Impurity A
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-32192 |
| Alternative Name(s) | (2b,3a,5a,16b,17b)-17-Acetoxy-3-hydroxy-2-(4-morpholinyl)-16-(1-pyrrolidinyl)androstane;CS-T-47024 |
| Research Area | This compound is used in the synthesis of the neuromuscular blocking agent rocuronium bromide. |
| Molecular Formula | C29H48N2O4 |
| CAS# | 119302-24-8 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1([C@H]2OC(C)=O)[C@](C[C@@H]2N3CCCC3)([H])[C@@](CC[C@]4([H])[C@@]5(C[C@H](N6CCOCC6)[C@@H](O)C4)C)([H])[C@]5([H])CC1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO32192.html |
| Additional Information | NULL |