LY255582 | MedChemExpress (MCE)
LY255582 is a pan-opioid antagonist and has high affinity for mu, delta, and kappa receptors (Ki: 0.4 nM, 5.2, 2.0 nM respectively). LY255582 can decrease food intake and body weight. LY255582 can be used for the research of obesity[1][2][3][4].
| Trivial name | LY255582 |
| Catalog Number | HY-118949 |
| Research Area | Metabolic Disease |
| CAS# | 119193-09-8 |
| Purity | ≥98.00% |
| SMILES | OC1=CC([C@]2([C@H](CN(CC2)CC[C@@H](C3CCCCC3)O)C)C)=CC=C1 |
| PubChem Chemical Structure ID | 9906198 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/ly255582.html |