PSI-7977 10mM * 1mL in DMSO
PSI-7977 is a phosphoramidate prodrug of PSI-7851, a nucleoside analog that, when phosphorylated, inhibits the RNA-dependent RNA polymerase of hepatitis C virus (EC50 = 92 nM).
Trivial name | PSI-7977 10mM * 1mL in DMSO |
Catalog Number | A11529-10mM-D |
Alternative Name(s) | N-[[P(S),2'R]-2'-Deoxy-2'-fluoro-2'-methyl-P-phenyl-5'-uridylyl]-L-alanine 1-methylethyl ester |
Molecular Formula | C22H29FN3O9P |
CAS# | 1190307-88-0 |
SMILES | C[C@@H](C(=O)OC(C)C)N[P@](=O)(OC[C@@H]1[C@H]([C@@]([C@@H](O1)N2C=CC(=O)NC2=O)(C)F)O)OC3=CC=CC=C3 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/psi-7977.html |