2-Hydroxy Desipramine D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02795 |
| Alternative Name(s) | 2-{3-[(²H3)methylamino]propyl}-2- aza3,5,7,11,13- hexaen-6-ol |
| Research Area | Labeled Desipramine, intended for use as an internal standard for the quantification of Desipramine by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H19D3N2O |
| CAS# | 1189998-63-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1=CC=C2N(C3=CC=CC=C3CCC2=C1)CCCNC([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02795.html |
| Additional Information | NULL |