Lidocaine D10 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06723 |
| Alternative Name(s) | 2-[bis(H5)ethylamino]-N-(2,6- dimethylphenyloride) |
| Research Area | Labeled Lidocaine, intended for use as an internal standard for the quantification of Lidocaine by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H13D1ClN2O |
| CAS# | 1189959-13-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(CN(C([2H])([2H])C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])[2H])NC(C(C)=CC=C1)=C1C.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06723.html |
| Additional Information | NULL |