Guanfacine 13C 15N3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03035 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Guanfacine, intended for use as an internal standard for the quantification of Guanfacine by GC- or LC-mass spectrometry. |
| Molecular Formula | C8[13C]H9Cl2[15N]3O |
| CAS# | 1189924-28-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C([15NH][13C]([15NH2])=[15NH])CC(C(Cl)=CC=C1)=C1Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03035.html |
| Additional Information | NULL |