N-Desmethyl Pirenzepine D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-15704 |
| Alternative Name(s) | 5,11-Dihydro-11-(1-piperazinyl-d8-acetyl)-6H-pyrido[2,3-b][1,4]benzodiazepin-6-one; |
| Research Area | Labeled Pirenzepine, intended for use as an internal standard for the quantification of Pirenzepine by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H11D8N5O2 |
| CAS# | 1189860-05-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C1=NC=CC=C1N2)C3=CC=CC=C3C2=O)CN4C([2H])([2H])C([2H])([2H])NC([2H])([2H])C4([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO15704.html |
| Additional Information | NULL |