Nevirapine D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02817 |
| Alternative Name(s) | 1thyl-6H-dipyrido[3,2-b:2,3-e][1,4]diazepin-6-one; BI-RG 587-d5;arapine-d5; Viramune-d5; |
| Research Area | Labelled Nevirapine , a potent (IC50=84nM) and selective non-nucleoside inhibitor of HIV-1 reverse transcriptase. Antiviral.;Labeled Nevirapine, intended for use as an internal standard for the quantification of Nevirapine by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H14N4O |
| CAS# | 1189717-29-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(NC2=O)C(N(C3([2H])C([2H])([2H])C3([2H])[2H])C4=NC=CC=C24)=NC=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02817.html |
| Additional Information | NULL |