Mesalamine 13C6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06757 |
| Alternative Name(s) | 5-Aminosalicylic acid-13C6;5-amino-2-hydroxy(1,2,3,4,5,6-c6)benzoc cid; Mesalazine 1c6. |
| Research Area | Labeled Mesalamine, intended for use as an internal standard for the quantification of Mesalamine by GC- or LC-mass spectrometry. |
| Molecular Formula | C7H7NO3Cl |
| CAS# | 1189709-96-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC([13C]([13CH]=[13C](N)[13CH]=[13CH]1)=[13C]1O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06757.html |
| Additional Information | NULL |
