4-Hydroxydiclofenac 13C6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-13600 |
| Alternative Name(s) | 2-[(2,6-Dichloro-4-hydroxyphenyl)amino](benzene-13C6)acetic Acid |
| Research Area | Labeled Diclofenac, intended for use as an internal standard for the quantification of Diclofenac by GC- or LC-mass spectrometry. |
| Molecular Formula | C813C6H11Cl2NO3 |
| CAS# | 1189656-64-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(C(Cl)=CC(O)=C1)N[13C]([13CH]=[13CH][13CH]=[13CH]2)=[13C]2CC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO13600.html |
| Additional Information | NULL |