Alpha Lipoic acid D5
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02965 |
| Alternative Name(s) | rac-a-Lipoic Acid-D5; 5-[(3,4,4-2H3)-1,2-dithiolan-3-yl](5,5- D2)pentanoic acid |
| Research Area | Labeled Lipoic Acid, intended for use as an internal standard for the quantification of Lipoic Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C8H9D5O2S2 |
| CAS# | 1189471-66-6 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CCCC([2H])([2H])C1([2H])C([2H])([2H])CSS1)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02965.html |
| Additional Information | NULL |