Loperamide D6 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16314 |
| Alternative Name(s) | 4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-di(D3)methyl-2,2-diphenylbutanamide hydrochloride |
| Research Area | Labeled Loperamide, intended for use as an internal standard for the quantification of Loperamide by GC- or LC-mass spectrometry. |
| Molecular Formula | C29H28D6Cl2N2O2 |
| CAS# | 1189469-46-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(N(C([2H])([2H])[2H])C([2H])([2H])[2H])C(C1=CC=CC=C1)(C2=CC=CC=C2)CCN3CCC(O)(C4=CC=C(Cl)C=C4)CC3.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16314.html |
| Additional Information | NULL |