Trimethoprim D9
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02914 |
| Alternative Name(s) | 5-[(3,4,5-Trimethoxy-d9-phenyl)methyl]- |
| Research Area | Deuterated Trimethoprim, an antibacterial.;Labeled Trimethoprim, intended for use as an internal standard for the quantification of Trimethoprim by GC- or LC-mass spectrometry. |
| Molecular Formula | C14H9D9N4O3 |
| CAS# | 1189460-62-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC1=NC(N)=NC=C1CC2=CC(OC([2H])([2H])[2H])=C(OC([2H])([2H])[2H])C(OC([2H])([2H])[2H])=C2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02914.html |
| Additional Information | NULL |