Lck Inhibitor III | MedChemExpress (MCE)
Lck Inhibitor III (compound 12h) is a potent Lck inhibitor, with an IC50 of 867 nM. Lck Inhibitor III inhibits IL-2 synthesis in Jurkat cells, with an IC50 of 1.270 μM[1].
| Trivial name | Lck Inhibitor III |
| Catalog Number | HY-112335 |
| Research Area | Cancer |
| CAS# | 1188890-30-3 |
| Purity | ≥98.00% |
| SMILES | CC1=CC=C(OC)C=C1NC2=NC(N3C4=CC=CC=C4N=C3)=NC(OCCN5CCOCC5)=C2.O |
| PubChem Chemical Structure ID | 46942352 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lck-inhibitor-iii.html |