ABT702 2HCl
ABT702 2HCl is a potent non-nucleoside adenosine kinase inhibitor with IC50 value of 1.7 nM, displaying oral activity in animal models of pain and inflammation.
| Trivial name | ABT 702 2HCl |
| Catalog Number | CSN21069 |
| Alternative Name(s) | ABT 702 2HCl |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C22H21BrCl2N6O |
| CAS# | 1188890-28-9 |
| Purity | ≥99% |
| SMILES | NC1=C(C(C2=CC=CC(Br)=C2)=CC(C3=CC=C(N4CCOCC4)N=C3)=N5)C5=NC=N1.[H]Cl.[H]Cl |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/abt702-2hcl.html |