Raloxifene D4 Hydrochloride
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06913 |
| Alternative Name(s) | 2-(4-hydroxyphenyl)-3-{4-[2-(piperidin-1-yl)(1,1,2,2-D4)ethoxy]benzoyl}-1-benzothiophen-6-ol hydrochloride; Keoxifene-d4; LY-139481-d4; Evista-d4; |
| Research Area | Labeled Raloxifene, intended for use as an internal standard for the quantification of Raloxifene by GC- or LC-mass spectrometry. |
| Molecular Formula | C28H24D4ClNO4S |
| CAS# | 1188263-47-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C1=CC=C(OC([2H])([2H])C([2H])([2H])N2CCCCC2)C=C1)C3=C(C4=CC=C(O)C=C4)SC5=CC(O)=CC=C35.Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06913.html |
| Additional Information | NULL |