Carglumic Acid
Carglumic acid (N-Carbamyl-L-glutamic acid), a functional analogue of N-acetylglutamate (NAG) and a carbamoyl phosphate synthetase 1 (CPS1) activator, is used to treat acute and chronic hyperammonemia associated with NAG synthase (NAGS) deficiency.
| Trivial name | N-Carbamyl-L-glutamic acid |
| Catalog Number | CSN25381 |
| Alternative Name(s) | N-Carbamyl-L-glutamic acid |
| Research Area | Metabolic Disease |
| Molecular Formula | C6H10N2O5 |
| CAS# | 1188-38-1 |
| Purity | ≥97% |
| SMILES | O=C(O)[C@@H](NC(N)=O)CCC(O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/carglumic-acid.html |