N-Acetylglutamic acid
N-Acetylglutamic acid is the first intermediate involved in the biosynthesis of arginine in prokaryotes and simple eukaryotes and a regulator in the process known as the urea cycle that converts toxic ammonia to urea for excretion from the body in vertebrates.
| Trivial name | / |
| Catalog Number | CSN24918 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C7H11NO5 |
| CAS# | 1188-37-0 |
| Purity | ≥98% |
| SMILES | O=C(O)CC[C@@H](C(O)=O)NC(C)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/n-acetylglutamic-acid.html |