2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)-1,2-propanediol
Impurities
| Trivial name | NULL |
| Catalog Number | CS-T-52891 |
| Alternative Name(s) | 2-(2,4-difluorophenyl)-3-(1H-1,2,4-triazol-1- yl)propane-1,2-diol; Fluconazole EP Impurity F |
| Research Area | 2-(2,4-Difluorophenyl)-3-(1H-1,2,4-triazol-1-yl)-1,2-propanediol is a diol impurity of the antifungal agent Fluconazole . |
| Molecular Formula | C11H11F2N3O2 |
| CAS# | 118689-07-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(CO)(C(C=CC(F)=C1)=C1F)CN2C=NC=N2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST52891.html |
| Additional Information | NULL |
