Evacetrapib (LY2484595) 10mM * 1mL in DMSO
Evacetrapib (LY2484595) is a drug that inhibits cholesterylester transfer protein, which transfers and thereby increases high-density lipoprotein and lowers low-density lipoprotein.
Trivial name | Evacetrapib (LY2484595) 10mM * 1mL in DMSO |
Catalog Number | A11397-10mM-D |
Alternative Name(s) | trans-4-[[(5S)-5-[[[3,5-Bis(trifluoromethyl)phenyl]methyl](2-methyl-2H-tetrazol-5-yl)amino]-2,3,4,5-tetrahydro-7,9-dimethyl-1H-1-benzazepin-1-yl]methyl]cyclohexanecarboxylic acid |
Molecular Formula | C31H36F6N6O2 |
CAS# | 1186486-62-3 |
SMILES | CC1=CC(=C2C(=C1)[C@H](CCCN2CC3CCC(CC3)C(=O)O)N(CC4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F)C5=NN(N=N5)C)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/evacetrapib-ly2484595.html |