Dantrolene 13C3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06526 |
| Alternative Name(s) | 1-((5-(4-nitrophenyl)furan-2-yl)methyleneamino)imidazolidine-2,4-dione-1c3 |
| Research Area | Labeled Dantrolene, intended for use as an internal standard for the quantification of Dantrolene by GC- or LC-mass spectrometry. A labelled muscle relaxant (skeletal). Used in the treatment of malignant hyperthermia. |
| Molecular Formula | C11(1C)3H10N4O5 |
| CAS# | 1185234-99-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[13C](N1)N([13CH2][13C]1=O)/N=C/C2=CC=C(C3=CC=C([N](=O)=O)C=C3)O2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06526.html |
| Additional Information | NULL |