N-desmethyl Sildenafil D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06962 |
| Alternative Name(s) | 5-[2-Ethoxy-5-(1-piperazinylsulfonyl)phenyl]-1,6-dihydro-1-methyl-3-propyl-7H-pyrazolo[4,3-d]pyrimidin-7-one-d8; Desmethylsildenafil-d8 |
| Research Area | Labeled Sildenafil, intended for use as an internal standard for the quantification of Sildenafil by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H20D8N6O4S |
| CAS# | 1185168-06-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CCCC1=NN(C)C2=C1NC(C(C=C([S](=O)(N3C([2H])([2H])C([2H])([2H])NC([2H])([2H])C3([2H])[2H])=O)C=C4)=C4OCC)=NC2=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06962.html |
| Additional Information | NULL |
