rac-5-Hydroxymethyl Tolterodine D14
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16008 |
| Alternative Name(s) | 2-(3-(bis(2,2,3,4,4-pentamethylpentan-3-yl)amino)-1-phenylpropyl)-4-(hydroxymethyl)phenol |
| Research Area | A labelled metabolite of Tolterodine, a muscarinic receptor antagonist used in the treatment of urinary incontinence. |
| Molecular Formula | C22H17D14NO2 |
| CAS# | 1185071-13-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC1=CC=C(CO)C=C1C(C2=CC=CC=C2)CCN(C(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])C(C([2H])([2H])[2H])([2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16008.html |
| Additional Information | NULL |