Gemfibrozil-d6
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02962 |
| Alternative Name(s) | 5-(2,5-dimethylphenoxy)-2,2- bis(H3)methylpentanoc cid |
| Research Area | An isotopically labelled analog of a serum lipid regulating agent used as an antihyperlipoproteinemic.;Labeled Gemfibrozil, intended for use as an internal standard for the quantification of Gemfibrozil by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H16D6O3 |
| CAS# | 1184986-45-5 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC1=C(C=C(C)C=C1)OCCCC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02962.html |
| Additional Information | NULL |