Cefquinome Sulfate
Cefquinome Sulfate is an antibacterial used in the treatment of infections caused by pathogens such as S. aureus, E. coli, Streptococcus, P. multocida and A. pleuropneumoniae.
| Trivial name | / |
| Catalog Number | CSN10584 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C23H26N6O9S3 |
| CAS# | 118443-89-3 |
| Purity | ≥97% |
| SMILES | O=C1[C@@H](NC(/C(C2=CSC(N)=N2)=N\OC)=O)[C@@]3([H])SCC(C[N+]4=C5CCCCC5=CC=C4)=C(C(O)=O)N13.[O-]S(=O)(O)=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/cefquinome-sulfate.html |
