NADP
Nicotinamide adenine dinucleotide phosphate. A coenzyme composed of ribosylnicotinamide 5′-phosphate (NMN) coupled by pyrophosphate linkage to the 5′-phosphate adenosine 2′,5′-bisphosphate. It serves as an electron carrier in a number of reactions, being alternately oxidized (NADP+) and reduced (NADPH).
| Catalog Number | API1184163 |
| Alternative Name(s) | Nadide phosphate monosodium NADP Sodium NADP sodium salt Sodium NADP |
| Research Area | NutritionHealthcare APIs |
| Molecular Formula | C21H27N7NaO17P3 |
| CAS# | 1184-16-3 |
| SMILES | C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)([O-])OCC3C(C(C(O3)N4C=NC5=C(N=CN=C54)N)OP(=O)(O)O)O)O)O)C(=O)N.[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/nadp-item-11845.html |