Zoledronic acid (Zoledronate)
Zoledronic acid (Zoledronate), a potent osteoclast inhibitor, induces apoptosis in osteoclasts by inhibiting enzymes of the mevalonate pathway and preventing the isoprenylation of small GTP-binding proteins such as Ras and Rho. Zoledronic acid (ZA) also induces autophagy.
| Trivial name | ZA, CGP-4244, GP42446A, ZOL 446 |
| Catalog Number | S1314 |
| Molecular Formula | C5H10N2O7P2 |
| CAS# | 118072-93-8 |
| Inchi | InChI=1S/C5H10N2O7P2/c8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7/h1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14) |
| Inchi Key | XRASPMIURGNCCH-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CC(O)(P(=O)(O)O)P(=O)(O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/Zoledronic-Acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Zoledronic-Acid-Zoledronate-chemical-structure-S1314.gif |