Zoledronic acid
Zoledronic acid is used to treat and prevent multiple forms of osteoporosis, hypercalcemia of malignancy, multiple myeloma, bone metastases from solid tumors, and Paget’s disease of bone.
| Catalog Number | API118072938 |
| Alternative Name(s) | Zoledronate Zometa Reclast |
| Research Area | Other APIs |
| Molecular Formula | C₅H₁₀N₂O₇P₂ |
| CAS# | 118072-93-8 |
| SMILES | C1=CN(C=N1)CC(O)(P(=O)(O)O)P(=O)(O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/zoledronic-acid-item-11992.html |