Zoledronic Acid
Zoledronic acid, a potent osteoclast inhibitor, induces apoptosis in osteoclasts by inhibiting enzymes of the mevalonate pathway and preventing the isoprenylation of small GTP-binding proteins such as Ras and Rho.
| Trivial name | Zoledronate; CGP 4244; CGP 42446A; ZOL-446 |
| Catalog Number | CSN19504 |
| Alternative Name(s) | Zoledronate; CGP 4244; CGP 42446A; ZOL-446 |
| Research Area | Cancer |
| Molecular Formula | C5H10N2O7P2 |
| CAS# | 118072-93-8 |
| Purity | ≥98% |
| SMILES | OC(CN1C=CN=C1)(P(O)(O)=O)P(O)(O)=O |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/zoledronic-acid.html |
