Limonin 500mg
Limonin is a limonoid, and a bitter, white, crystalline substance found in citrus and other plants. It is also known as limonoate D-ring-lactone and limonoic acid di-delta-lactone.
| Trivial name | Limonin 500mg |
| Catalog Number | A10531-500 |
| Alternative Name(s) | 7,16-Dioxo-7,16-dideoxylimondiol |
| Molecular Formula | C26H30O8 |
| CAS# | 1180-71-8 |
| SMILES | C[C@@]12CC[C@H]3[C@]([C@@]14[C@H](O4)C(=O)O[C@H]2C5=COC=C5)(C(=O)C[C@@H]6[C@@]37COC(=O)C[C@@H]7OC6(C)C)C |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/limonin.html |
