Trimethylgallic Acid
Trimethylgallic acid, a natural product isolated and purified from the branchs of Eucalyptus globulus Labill, exert hepatoprotective effects in CCl4-induced rats, specifically by modulating oxidative-nitrosative stress and inflammation.
| Trivial name | 3,4,5-Trimethoxybenzoic Acid |
| Catalog Number | CSN19322 |
| Alternative Name(s) | 3,4,5-Trimethoxybenzoic Acid |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C10H12O5 |
| CAS# | 118-41-2 |
| Purity | ≥99% |
| SMILES | O=C(O)C1=CC(OC)=C(OC)C(OC)=C1 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/trimethylgallic-acid.html |
