Rabeprazole D4 sodium salt
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02936 |
| Alternative Name(s) | sodium 2-{[4-(3-methoxypropoxy)-3-methylpyridin-2- yl]methanesulfinyl}(H4)-1H-1,3-benzodiazol-1-ide ; CS-P-06046 |
| Research Area | Labeled Rabeprazole, intended for use as an internal standard for the quantification of Rabeprazole by GC- or LC-mass spectrometry. |
| Molecular Formula | C18H16D4N3NaO3S |
| CAS# | 117976-90-6 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=S(CC1=C(C)C(OCCCOC)=CC=N1)C2=NC3=C(C([2H])=C(C([2H])=C3N2)[2H])[2H].[NaH] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02936.html |
| Additional Information | NULL |