Rabeprazole Sodium
A 4-(3-methoxypropoxy)-3-methylpyridinyl derivative of timoprazole that is used in the therapy of STOMACH ULCERS and ZOLLINGER-ELLISON SYNDROME. The drug inhibits H(+)-K(+)-EXCHANGING ATPASE which is found in GASTRIC PARIETAL CELLS.
| Catalog Number | API117976906 |
| Alternative Name(s) | Rebeprazole sodium Pariet Rabeprazole sodium salt |
| Research Area | Anti-Acid APIs |
| Molecular Formula | C18H20N3NaO3S |
| CAS# | 117976-90-6 |
| SMILES | CC1=C(C=CN=C1CS(=O)C2=NC3=CC=CC=C3[N-]2)OCCCOC.[Na+] |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/rabeprazole-sodium-item-6076.html |