Rabeprazole
API Standard
| Catalog Number | CS-O-05154 |
| Alternative Name(s) | 2-{[4-(3-methoxypropoxy)-3-methylpyridin-2- yl]methanesulfinyl}-1H-1,3-benzodiazole |
| Research Area | Rabeprazole is an antiulcer drug in the class of proton pump inhibitors. It is a prodrug - in the acid environment of the parietal cells it turns into active sulphenamide form. Rabeprazole inhibits the H+, K+ATPase of the coating gastric cells and dose-de |
| Molecular Formula | C18H21N3O3S |
| CAS# | 117976-89-3 |
| Purity | >98% |
| SMILES | O=[S](C1=NC(C=CC=C2)=C2N1)CC(N=CC=C3OCCCOC)=C3C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05154.html |