Cyclophosphamide D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-06517 |
| Alternative Name(s) | 2-(bissphinane 2-oxide D8 |
| Research Area | Labeled Cyclophosphamide, intended for use as an internal standard for the quantification of Cyclophosphamide by GC- or LC-mass spectrometry. |
| Molecular Formula | C7H7DCl2N2O2P |
| CAS# | 1178903-96-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=[P]1(NCCCO1)N(C([2H])([2H])C([2H])([2H])Cl)C([2H])([2H])C([2H])([2H])Cl |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06517.html |
| Additional Information | NULL |