Azithromycin Dihydrate
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-00854 |
| Alternative Name(s) | Toraseptol;Ultreon;Azithromycin dihydrate Azitro;N-Methyl-11-aza-10-deoxo-10-dihydroerythromycin A, CP-62993 ;(2R,3S,4R,5R,8R,10R,11R,12S,13S,14R)-13-((2,6-Dideoxyhexopyranosyl)oxy)-2-ethyl-3,4,10-trihydroxy-3,5,6,8,10,12,14-heptamethyl-11-((3,4,6-trideoxy-3-(dimethylamino)-β-D-xylo-hexopyranosyl)oxy)-1-oxa-6-15-one dihydrate 9-Deoxo-9a-aza-9a-methyl-9a-homoerythromycin A dihydrate; Azadose; Azatek; Azithromycin dihydrate Azitro; CP 62993; CP-62,993; Goxal; Odaz; Ribotrex; Toraseptol; Ultreon; UNII-5FD1131I7S; Vinzam; XZ-450; Zenstavion; Zithromax; Zmax; |
| Research Area | A semi-synthetic macrolide antibiotic. It has been used in the treatment of Mycobacterium avium intracellulare infections, toxoplasmosis, and cryptosporidiosis. |
| Molecular Formula | C38H72N2O12-2H2O |
| CAS# | 117772-70-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@H]([C@@H]([C@H](C(O[C@@H]([C@@](C)(O)[C@@H]1O)CC)=O)C)O[C@@](O[C@@H](C)[C@@H]2O)([H])C[C@@]2(C)OC)[C@H]([C@](O)(C[C@H](CN([C@@H]1C)C)C)C)O[C@@](O[C@H](C)C[C@@H]3N(C)C)([H])[C@@H]3O.O.O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00854.html |
| Additional Information | NULL |
