AL 8810 methyl ester | MedChemExpress (MCE)
AL 8810 methyl ester is a prostaglandin F(2α) analog and a prostaglandin F(2α) receptor agonist. Can competitively antagonize the effects of the FP receptor agonist Fluprostenol (HY-108560). AL 8810 methyl ester has no significant potency against TP, DP, EP(2), EP(4) receptor subtypes in cell lines[1].
| Trivial name | AL 8810 methyl ester |
| Catalog Number | HY-118190 |
| Research Area | Endocrinology |
| CAS# | 1176541-11-9 |
| Purity | ≥98.0% |
| SMILES | O[C@H](C1CC2=CC=CC=C2C1)/C=C/[C@@H]3[C@H]([C@H](C[C@@H]3F)O)C/C=C\CCCC(OC)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/al-8810-methyl-ester.html |