Raptinal
Raptinal is a pro-apoptotic compound that induces apoptosis by promoting the release of cytochrome c from the mitochondria, thereby activating the intrinsic apoptotic pathway. It also inhibits the activity of caspase-activated Pannexin 1 (PANX1), a ubiquitously expressed transmembrane channel involved in regulating various cell death-associated processes.
| Catalog Number | E1560 |
| Molecular Formula | C21H22F2N6O2 |
| CAS# | 1176-09-6 |
| SMILES | CNC(=O)C1=NC(=C(C=C1)N2CCN(CC2)CC3=CC=C4N=C(C)C(=O)NC4=C3F)F |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/raptinal.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E1560-Raptinal-chemical-structure.png |
