Vadimezan (DMXAA)
Vadimezan (DMXAA) is a vascular disrupting agents (VDA) and competitive inhibitor of DT-diaphorase with Ki of 20 μM and IC50 of 62.5 μM in cell-free assays, respectively. DMXAA (Vadimezan) is also a STING agonist with potential antineoplastic activity. DMXAA (Vadimezan) potently induces IFN-β but relatively low TNF-α expression in vitro. DMXAA (Vadimezan) has antiviral activity. Phase 3.
| Trivial name | ASA404, NSC 640488 |
| Catalog Number | S1537 |
| Molecular Formula | C16H8Cl4N2O2 |
| CAS# | 117570-53-3 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | ClC1=CC(=C(OC2=CC=C(OC3=C(Cl)C=C(Cl)C=N3)C=C2)N=C1)Cl |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/DMXAA(ASA404).html |
| Additional Information | https://file.selleck.cn/downloads/struct/DMXAA-ASA404-chemical-structure-S1537.gif |
