DMXAA (ASA404) 10mM * 1mL in DMSO
DMXAA (ASA404) is a tumor-vascular disrupting agent (tumor-VDA) that attacks the blood supply of a cancerous tumor to cause tumor regression.
| Trivial name | DMXAA (ASA404) 10mM * 1mL in DMSO |
| Catalog Number | A10324-10mM-D |
| Alternative Name(s) | (5,6-Dimethyl-9-oxo-9H-xanthen-4-yl)-acetic acid |
| Molecular Formula | C17H14O4 |
| CAS# | 117570-53-3 |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C3=C(O2)C(=CC=C3)CC(=O)O)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/dmxaa-asa404.html |