Cefditoren Pivoxil
Cefditoren Pivoxil is a third-generation oral cephalosporin with a broad spectrum of activity against pathogens, including both Gram-positive and -negative bacteria, and is stable to hydrolysis by many common β-lactamases.
| Trivial name | ME-1207; Cefditoren Pivaloyloxymethyl Ester |
| Catalog Number | CSN10568 |
| Alternative Name(s) | ME-1207; Cefditoren Pivaloyloxymethyl Ester |
| Research Area | / |
| Molecular Formula | C25H28N6O7S3 |
| CAS# | 117467-28-4 |
| Purity | ≥99% |
| SMILES | O=C(C(N12)=C(/C=C\C3=C(C)N=CS3)CS[C@]2([H])[C@H](NC(/C(C4=CSC(N)=N4)=N\OC)=O)C1=O)OCOC(C(C)(C)C)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/cefditoren-pivoxil.html |
