Tricyclic cytosine tC | MedChemExpress (MCE)
Tricyclic cytosine tC is a fluorescent base analogue that can be used as a fluorescent probe in nucleic acid-containing systems. The excitation wavelength is 385 nm and the emission wavelength is 505 nm[1][2].
| Trivial name | Tricyclic cytosine tC |
| Catalog Number | HY-161164 |
| Research Area | Others |
| CAS# | 1174063-74-1 |
| Purity | ≥98.0% |
| SMILES | O=C1N([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C=C(SC3=CC=CC=C3N4)C4=N1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tricyclic-cytosine-tc.html |