BMS-794833 10mM * 1mL in DMSO
BMS-794833 is a potent ATP competitive inhibitor to Met and VEGFR-2 with IC50 of 1.7 and 15 nmol.
| Trivial name | BMS-794833 10mM * 1mL in DMSO |
| Catalog Number | A10154-10mM-D |
| Alternative Name(s) | N-(4-((2-amino-3-chloropyridin-4-yl)oxy)-3-fluorophenyl)-5-(4-fluorophenyl)-4-oxo-1,4-dihydropyridine-3-carboxamide |
| Molecular Formula | C23H15ClF2N4O3 |
| CAS# | 1174046-72-0 |
| SMILES | C1=CC(=CC=C1C2=CNC=C(C2=O)C(=O)NC3=CC(=C(C=C3)OC4=C(C(=NC=C4)N)Cl)F)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/bms-794833.html |