Difloxacin D3
Marine
| Trivial name | NULL |
| Catalog Number | CS-O-16394 |
| Alternative Name(s) | 6-fluoro-1-(4-fluorophenyl)-7-[4-(D3)methylpiperazin-1-yl]-4-oxo-1,4-dihydroquinoline-3-carboxylic acid |
| Research Area | Labeled Difloxacin, intended for use as an internal standard for the quantification of Difloxacin by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H16D3F2N3O3 |
| CAS# | 1173147-93-7 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1C2=CC(F)=C(N3CCN(C([2H])([2H])[2H])CC3)C=C2N(C4=CC=C(F)C=C4)C=C1C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16394.html |
| Additional Information | NULL |