U0126-EtOH 10mM * 1mL in DMSO
U0126-EtOH is an inhibitor of both MEK1 and MEK2 with an IC50 of 72 nM and 58 nM respectively.
| Trivial name | U0126-EtOH 10mM * 1mL in DMSO |
| Catalog Number | A10957-10mM-D |
| Alternative Name(s) | (2Z,3Z)-2,3-bis[amino-(2-aminophenyl)sulfanylmethylidene]butanedinitrile; ethanol |
| Molecular Formula | C18H16N6S2.C2H6O |
| CAS# | 1173097-76-1 |
| SMILES | CCO.C1=CC=C(C(=C1)N)S/C(=C(/C(=C(/SC2=CC=CC=C2N)N)/C#N)C#N)/N |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/u0126-etoh.html |
