2-NP-AMOZ D5
Marine
| Trivial name | NULL |
| Catalog Number | CS-W-00153 |
| Alternative Name(s) | 5-(4-Morpholinylmethyl)-3-[[(2-nitrophenyl)methylene]amino]-;2-NP-AMOZ-d5 CTK8F4471. |
| Research Area | A labelled derivatized of AMOZ , a metabolite of Nitrofuran.;Application of Labeled APIs: Labeled AMOZ, intended for use as an internal standard for the quantification of AMOZ by GC- or LC-mass spectrometry. |
| Molecular Formula | C15H13D5N4O5 |
| CAS# | 1173097-59-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C1OC(C([2H])([2H])N1/N=C/C(C=CC=C2)=C2[N](=O)=O)([2H])C([2H])([2H])N3CCOCC3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSW00153.html |
| Additional Information | NULL |