α-Cyano-4-hydroxycinnamic acid-[d7]
α-Cyano-4-hydroxycinnamic acid-[d7], is the labelled analogue of α-Cyano-4-hydroxycinnamic acid. CHCA is a monocarboxylic acid transport (MCT) inhibitor, displaying antitumoral and antiangiogenic activity in gliomas in vivo. It decreases glycolytic metabolism, migration and invasion in U251 cells, enhances the effect of temozolomide.
| Catalog Number | BLP-000305 |
| Alternative Name(s) | α-Cyano-4-hydroxycinnamic acid-d7 |
| Molecular Formula | C10D7NO3 |
| CAS# | 1173097-47-6 |
| Purity | 97% |
| Inchi | InChI=1S/C10H7NO3/c11-6-8(10(13)14)5-7-1-3-9(12)4-2-7/h1-5,12H,(H,13,14)/b8-5+/i1D,2D,3D,4D,5D/hD2 |
| Inchi Key | AFVLVVWMAFSXCK-BMKBMMDNSA-N |
| Size | Please inquire |
| Supplier Page | https://isotope.bocsci.com/product/cyano-4-hydroxycinnamic-acid-d7-cas-1173097-47-6-344162.html |