Melamine-13C3 | MedChemExpress (MCE)
Melamine-13C3 is the 13C labeled Melamine[1]. Melamine is a metabolite of cyromazine. Melamine is a intermediate for the synthesis of melamine resin and plastic materials[2].
| Trivial name | Melamine-13C3 |
| Catalog Number | HY-Y1117S1 |
| Research Area | Others |
| CAS# | 1173022-88-2 |
| Purity | ≥98.00% |
| SMILES | N[13C]1=N[13C](N)=N[13C](N)=N1 |
| PubChem Chemical Structure ID | 71309406 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/melamine-13c3.html |